C16H16ClF2N3O3 — CID 138996348
4-(5-chloro-2-methoxypyrimidin-4-yl)-2-[4-(difluoromethoxy)phenyl]morpholine (PubChem CID 138996348) has the molecular formula C16H16ClF2N3O3 and a molecular weight of 371.77 g/mol. Its IUPAC name is 4-(5-chloro-2-methoxypyrimidin-4-yl)-2-[4-(difluoromethoxy)phenyl]morpholine.
| Compound Name | 4-(5-chloro-2-methoxypyrimidin-4-yl)-2-[4-(difluoromethoxy)phenyl]morpholine |
|---|---|
| PubChem CID | 138996348 |
| Molecular Formula | C16H16ClF2N3O3 |
| Molecular Weight | 371.77 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 4-(5-chloro-2-methoxypyrimidin-4-yl)-2-[4-(difluoromethoxy)phenyl]morpholine |
| SMILES | COc1ncc(Cl)c(N2CCOC(c3ccc(OC(F)F)cc3)C2)n1 |
| InChI | InChI=1S/C16H16ClF2N3O3/c1-23-16-20-8-12(17)14(21-16)22-6-7-24-13(9-22)10-2-4-11(5-3-10)25-15(18)19/h2-5,8,13,15H,6-7,9H2,1H3 |
| InChIKey | PFRATPXBAPNHIL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.77 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |