C18H23N3O2 — CID 138996495
4-(4,6-dimethyl-1H-indole-2-carbonyl)-3-propylpiperazin-2-one (PubChem CID 138996495) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 4-(4,6-dimethyl-1H-indole-2-carbonyl)-3-propylpiperazin-2-one.
| Compound Name | 4-(4,6-dimethyl-1H-indole-2-carbonyl)-3-propylpiperazin-2-one |
|---|---|
| PubChem CID | 138996495 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 4-(4,6-dimethyl-1H-indole-2-carbonyl)-3-propylpiperazin-2-one |
| SMILES | CCCC1C(=O)NCCN1C(=O)c1cc2c(C)cc(C)cc2[nH]1 |
| InChI | InChI=1S/C18H23N3O2/c1-4-5-16-17(22)19-6-7-21(16)18(23)15-10-13-12(3)8-11(2)9-14(13)20-15/h8-10,16,20H,4-7H2,1-3H3,(H,19,22) |
| InChIKey | HHYVATRSMHHIQQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |