C18H21N3O2 — CID 138997163
4-methyl-N-[1-(methylcarbamoyl)cyclopentyl]quinoline-6-carboxamide (PubChem CID 138997163) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is 4-methyl-N-[1-(methylcarbamoyl)cyclopentyl]quinoline-6-carboxamide.
| Compound Name | 4-methyl-N-[1-(methylcarbamoyl)cyclopentyl]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 138997163 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 4-methyl-N-[1-(methylcarbamoyl)cyclopentyl]quinoline-6-carboxamide |
| SMILES | CNC(=O)C1(NC(=O)c2ccc3nccc(C)c3c2)CCCC1 |
| InChI | InChI=1S/C18H21N3O2/c1-12-7-10-20-15-6-5-13(11-14(12)15)16(22)21-18(17(23)19-2)8-3-4-9-18/h5-7,10-11H,3-4,8-9H2,1-2H3,(H,19,23)(H,21,22) |
| InChIKey | FQCKIBZQZGWWNA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |