C23H27N3O2 — CID 118783080
3-(1,3-dihydroisoindol-2-yl)-N-[1-(methylcarbamoyl)cyclohexyl]benzamide (PubChem CID 118783080) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 3-(1,3-dihydroisoindol-2-yl)-N-[1-(methylcarbamoyl)cyclohexyl]benzamide.
| Compound Name | 3-(1,3-dihydroisoindol-2-yl)-N-[1-(methylcarbamoyl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 118783080 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 3-(1,3-dihydroisoindol-2-yl)-N-[1-(methylcarbamoyl)cyclohexyl]benzamide |
| SMILES | CNC(=O)C1(NC(=O)c2cccc(N3Cc4ccccc4C3)c2)CCCCC1 |
| InChI | InChI=1S/C23H27N3O2/c1-24-22(28)23(12-5-2-6-13-23)25-21(27)17-10-7-11-20(14-17)26-15-18-8-3-4-9-19(18)16-26/h3-4,7-11,14H,2,5-6,12-13,15-16H2,1H3,(H,24,28)(H,25,27) |
| InChIKey | ARGPGWRFMMTCOH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |