C22H26N2O2 — CID 91795638
3-(1,3-dihydroisoindol-2-yl)-N-[1-(3-hydroxycyclobutyl)propyl]benzamide (PubChem CID 91795638) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 3-(1,3-dihydroisoindol-2-yl)-N-[1-(3-hydroxycyclobutyl)propyl]benzamide.
| Compound Name | 3-(1,3-dihydroisoindol-2-yl)-N-[1-(3-hydroxycyclobutyl)propyl]benzamide |
|---|---|
| PubChem CID | 91795638 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 3-(1,3-dihydroisoindol-2-yl)-N-[1-(3-hydroxycyclobutyl)propyl]benzamide |
| SMILES | CCC(NC(=O)c1cccc(N2Cc3ccccc3C2)c1)C1CC(O)C1 |
| InChI | InChI=1S/C22H26N2O2/c1-2-21(18-11-20(25)12-18)23-22(26)15-8-5-9-19(10-15)24-13-16-6-3-4-7-17(16)14-24/h3-10,18,20-21,25H,2,11-14H2,1H3,(H,23,26) |
| InChIKey | VPXLINTZUZTACW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |