C19H22N4O — CID 139001345
1-(1H-indazol-5-yl)-3-(2-methyl-4-phenylbutan-2-yl)urea (PubChem CID 139001345) has the molecular formula C19H22N4O and a molecular weight of 322.41 g/mol. Its IUPAC name is 1-(1H-indazol-5-yl)-3-(2-methyl-4-phenylbutan-2-yl)urea.
| Compound Name | 1-(1H-indazol-5-yl)-3-(2-methyl-4-phenylbutan-2-yl)urea |
|---|---|
| PubChem CID | 139001345 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 1-(1H-indazol-5-yl)-3-(2-methyl-4-phenylbutan-2-yl)urea |
| SMILES | CC(C)(CCc1ccccc1)NC(=O)Nc1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C19H22N4O/c1-19(2,11-10-14-6-4-3-5-7-14)22-18(24)21-16-8-9-17-15(12-16)13-20-23-17/h3-9,12-13H,10-11H2,1-2H3,(H,20,23)(H2,21,22,24) |
| InChIKey | DEGVQSMFRZFZBT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |