C17H18N4O2 — CID 70689793
1-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-3-(1H-indazol-5-yl)urea (PubChem CID 70689793) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 1-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-3-(1H-indazol-5-yl)urea.
| Compound Name | 1-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-3-(1H-indazol-5-yl)urea |
|---|---|
| PubChem CID | 70689793 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 1-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-3-(1H-indazol-5-yl)urea |
| SMILES | O=C(Nc1ccc2[nH]ncc2c1)N[C@H](CO)Cc1ccccc1 |
| InChI | InChI=1S/C17H18N4O2/c22-11-15(8-12-4-2-1-3-5-12)20-17(23)19-14-6-7-16-13(9-14)10-18-21-16/h1-7,9-10,15,22H,8,11H2,(H,18,21)(H2,19,20,23)/t15-/m0/s1 |
| InChIKey | HRUSHJHVNFDTLY-HNNXBMFYSA-N |
| XLogP | 2.29 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |