C17H16FN3O2 — CID 95980553
1-(3-cyano-4-fluorophenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]urea (PubChem CID 95980553) has the molecular formula C17H16FN3O2 and a molecular weight of 313.33 g/mol. Its IUPAC name is 1-(3-cyano-4-fluorophenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]urea.
| Compound Name | 1-(3-cyano-4-fluorophenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]urea |
|---|---|
| PubChem CID | 95980553 |
| Molecular Formula | C17H16FN3O2 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 1-(3-cyano-4-fluorophenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]urea |
| SMILES | N#Cc1cc(NC(=O)N[C@@H](CO)Cc2ccccc2)ccc1F |
| InChI | InChI=1S/C17H16FN3O2/c18-16-7-6-14(9-13(16)10-19)20-17(23)21-15(11-22)8-12-4-2-1-3-5-12/h1-7,9,15,22H,8,11H2,(H2,20,21,23)/t15-/m1/s1 |
| InChIKey | JWMJGVKJFVQVGZ-OAHLLOKOSA-N |
| XLogP | 2.42 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |