C19H20N6O3S — CID 139004329
N-cyclopropyl-4-methyl-3-[[3-(1-methyltetrazol-5-yl)phenyl]sulfonylamino]benzamide (PubChem CID 139004329) has the molecular formula C19H20N6O3S and a molecular weight of 412.48 g/mol. Its IUPAC name is N-cyclopropyl-4-methyl-3-[[3-(1-methyltetrazol-5-yl)phenyl]sulfonylamino]benzamide.
| Compound Name | N-cyclopropyl-4-methyl-3-[[3-(1-methyltetrazol-5-yl)phenyl]sulfonylamino]benzamide |
|---|---|
| PubChem CID | 139004329 |
| Molecular Formula | C19H20N6O3S |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N-cyclopropyl-4-methyl-3-[[3-(1-methyltetrazol-5-yl)phenyl]sulfonylamino]benzamide |
| SMILES | Cc1ccc(C(=O)NC2CC2)cc1NS(=O)(=O)c1cccc(-c2nnnn2C)c1 |
| InChI | InChI=1S/C19H20N6O3S/c1-12-6-7-14(19(26)20-15-8-9-15)11-17(12)22-29(27,28)16-5-3-4-13(10-16)18-21-23-24-25(18)2/h3-7,10-11,15,22H,8-9H2,1-2H3,(H,20,26) |
| InChIKey | VWORWJIAFWCYBQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |