C17H21N3O2 — CID 139004864
1-[3-(hydroxymethyl)-3-phenylpyrrolidin-1-yl]-2-(3-methylimidazol-4-yl)ethanone (PubChem CID 139004864) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 1-[3-(hydroxymethyl)-3-phenylpyrrolidin-1-yl]-2-(3-methylimidazol-4-yl)ethanone.
| Compound Name | 1-[3-(hydroxymethyl)-3-phenylpyrrolidin-1-yl]-2-(3-methylimidazol-4-yl)ethanone |
|---|---|
| PubChem CID | 139004864 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 1-[3-(hydroxymethyl)-3-phenylpyrrolidin-1-yl]-2-(3-methylimidazol-4-yl)ethanone |
| SMILES | Cn1cncc1CC(=O)N1CCC(CO)(c2ccccc2)C1 |
| InChI | InChI=1S/C17H21N3O2/c1-19-13-18-10-15(19)9-16(22)20-8-7-17(11-20,12-21)14-5-3-2-4-6-14/h2-6,10,13,21H,7-9,11-12H2,1H3 |
| InChIKey | JJUDPNWWNZEVHU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |