C20H20BrF2NO2 — CID 167915033
2-(3-bromo-2,6-difluorophenyl)-1-[3-(hydroxymethyl)-3-phenylpiperidin-1-yl]ethanone (PubChem CID 167915033) has the molecular formula C20H20BrF2NO2 and a molecular weight of 424.29 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)-1-[3-(hydroxymethyl)-3-phenylpiperidin-1-yl]ethanone.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)-1-[3-(hydroxymethyl)-3-phenylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 167915033 |
| Molecular Formula | C20H20BrF2NO2 |
| Molecular Weight | 424.29 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)-1-[3-(hydroxymethyl)-3-phenylpiperidin-1-yl]ethanone |
| SMILES | O=C(Cc1c(F)ccc(Br)c1F)N1CCCC(CO)(c2ccccc2)C1 |
| InChI | InChI=1S/C20H20BrF2NO2/c21-16-7-8-17(22)15(19(16)23)11-18(26)24-10-4-9-20(12-24,13-25)14-5-2-1-3-6-14/h1-3,5-8,25H,4,9-13H2 |
| InChIKey | RXIHNKSHILEXJP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|