C16H20BrN2S+ — CID 1390058
4-(3-bromophenyl)-2-(1-ethylpiperidin-1-ium-4-yl)-1,3-thiazole (PubChem CID 1390058) has the molecular formula C16H20BrN2S+ and a molecular weight of 352.32 g/mol. Its IUPAC name is 4-(3-bromophenyl)-2-(1-ethylpiperidin-1-ium-4-yl)-1,3-thiazole.
| Compound Name | 4-(3-bromophenyl)-2-(1-ethylpiperidin-1-ium-4-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 1390058 |
| Molecular Formula | C16H20BrN2S+ |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 4-(3-bromophenyl)-2-(1-ethylpiperidin-1-ium-4-yl)-1,3-thiazole |
| SMILES | CC[NH+]1CCC(c2nc(-c3cccc(Br)c3)cs2)CC1 |
| InChI | InChI=1S/C16H19BrN2S/c1-2-19-8-6-12(7-9-19)16-18-15(11-20-16)13-4-3-5-14(17)10-13/h3-5,10-12H,2,6-9H2,1H3/p+1 |
| InChIKey | UOIUXZCCHBUOLE-UHFFFAOYSA-O |
| XLogP | 3.35 |
| TPSA | 17.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |