C14H16N2S — CID 116888849
3-(2-cyclobutyl-1,3-thiazol-4-yl)-N-methylaniline (PubChem CID 116888849) has the molecular formula C14H16N2S and a molecular weight of 244.36 g/mol. Its IUPAC name is 3-(2-cyclobutyl-1,3-thiazol-4-yl)-N-methylaniline.
| Compound Name | 3-(2-cyclobutyl-1,3-thiazol-4-yl)-N-methylaniline |
|---|---|
| PubChem CID | 116888849 |
| Molecular Formula | C14H16N2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 3-(2-cyclobutyl-1,3-thiazol-4-yl)-N-methylaniline |
| SMILES | CNc1cccc(-c2csc(C3CCC3)n2)c1 |
| InChI | InChI=1S/C14H16N2S/c1-15-12-7-3-6-11(8-12)13-9-17-14(16-13)10-4-2-5-10/h3,6-10,15H,2,4-5H2,1H3 |
| InChIKey | JKSXOKCMQQURHL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |