C15H14F3N3O2 — CID 139006620
6-cyclopropyl-2-[(6-methoxy-3-pyridinyl)methyl]-4-(trifluoromethyl)pyridazin-3-one (PubChem CID 139006620) has the molecular formula C15H14F3N3O2 and a molecular weight of 325.29 g/mol. Its IUPAC name is 6-cyclopropyl-2-[(6-methoxy-3-pyridinyl)methyl]-4-(trifluoromethyl)pyridazin-3-one.
| Compound Name | 6-cyclopropyl-2-[(6-methoxy-3-pyridinyl)methyl]-4-(trifluoromethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 139006620 |
| Molecular Formula | C15H14F3N3O2 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 6-cyclopropyl-2-[(6-methoxy-3-pyridinyl)methyl]-4-(trifluoromethyl)pyridazin-3-one |
| SMILES | COc1ccc(Cn2nc(C3CC3)cc(C(F)(F)F)c2=O)cn1 |
| InChI | InChI=1S/C15H14F3N3O2/c1-23-13-5-2-9(7-19-13)8-21-14(22)11(15(16,17)18)6-12(20-21)10-3-4-10/h2,5-7,10H,3-4,8H2,1H3 |
| InChIKey | WQWBQIZBTNQFPM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |