C15H21F3N4O2 — CID 139008217
1-tert-butyl-N-(1-methyl-2-oxopiperidin-3-yl)-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 139008217) has the molecular formula C15H21F3N4O2 and a molecular weight of 346.35 g/mol. Its IUPAC name is 1-tert-butyl-N-(1-methyl-2-oxopiperidin-3-yl)-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 1-tert-butyl-N-(1-methyl-2-oxopiperidin-3-yl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 139008217 |
| Molecular Formula | C15H21F3N4O2 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 1-tert-butyl-N-(1-methyl-2-oxopiperidin-3-yl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | CN1CCCC(NC(=O)c2cnn(C(C)(C)C)c2C(F)(F)F)C1=O |
| InChI | InChI=1S/C15H21F3N4O2/c1-14(2,3)22-11(15(16,17)18)9(8-19-22)12(23)20-10-6-5-7-21(4)13(10)24/h8,10H,5-7H2,1-4H3,(H,20,23) |
| InChIKey | KAQUIJUFFCAYIK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |