C19H25F4N3O — CID 58972818
1-tert-butyl-N-(5-fluoro-2-adamantyl)-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 58972818) has the molecular formula C19H25F4N3O and a molecular weight of 387.42 g/mol. Its IUPAC name is 1-tert-butyl-N-(5-fluoro-2-adamantyl)-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 1-tert-butyl-N-(5-fluoro-2-adamantyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 58972818 |
| Molecular Formula | C19H25F4N3O |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 1-tert-butyl-N-(5-fluoro-2-adamantyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | CC(C)(C)n1ncc(C(=O)NC2C3CC4CC2CC(F)(C4)C3)c1C(F)(F)F |
| InChI | InChI=1S/C19H25F4N3O/c1-17(2,3)26-15(19(21,22)23)13(9-24-26)16(27)25-14-11-4-10-5-12(14)8-18(20,6-10)7-11/h9-12,14H,4-8H2,1-3H3,(H,25,27) |
| InChIKey | DWFNBHVVTSEPPC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |