C23H36N4O — CID 25011906
N-(2-adamantyl)-1-tert-butyl-5-piperidin-1-ylpyrazole-4-carboxamide (PubChem CID 25011906) has the molecular formula C23H36N4O and a molecular weight of 384.57 g/mol. Its IUPAC name is N-(2-adamantyl)-1-tert-butyl-5-piperidin-1-ylpyrazole-4-carboxamide.
| Compound Name | N-(2-adamantyl)-1-tert-butyl-5-piperidin-1-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 25011906 |
| Molecular Formula | C23H36N4O |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | N-(2-adamantyl)-1-tert-butyl-5-piperidin-1-ylpyrazole-4-carboxamide |
| SMILES | CC(C)(C)n1ncc(C(=O)NC2C3CC4CC(C3)CC2C4)c1N1CCCCC1 |
| InChI | InChI=1S/C23H36N4O/c1-23(2,3)27-22(26-7-5-4-6-8-26)19(14-24-27)21(28)25-20-17-10-15-9-16(12-17)13-18(20)11-15/h14-18,20H,4-13H2,1-3H3,(H,25,28) |
| InChIKey | VLWSIQBJHKARQX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |