C23H36N4O2 — CID 67021017
N-(1-adamantyl)-1-tert-butyl-5-(4-hydroxypiperidin-1-yl)pyrazole-4-carboxamide (PubChem CID 67021017) has the molecular formula C23H36N4O2 and a molecular weight of 400.57 g/mol. Its IUPAC name is N-(1-adamantyl)-1-tert-butyl-5-(4-hydroxypiperidin-1-yl)pyrazole-4-carboxamide.
| Compound Name | N-(1-adamantyl)-1-tert-butyl-5-(4-hydroxypiperidin-1-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 67021017 |
| Molecular Formula | C23H36N4O2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | N-(1-adamantyl)-1-tert-butyl-5-(4-hydroxypiperidin-1-yl)pyrazole-4-carboxamide |
| SMILES | CC(C)(C)n1ncc(C(=O)NC23CC4CC(CC(C4)C2)C3)c1N1CCC(O)CC1 |
| InChI | InChI=1S/C23H36N4O2/c1-22(2,3)27-21(26-6-4-18(28)5-7-26)19(14-24-27)20(29)25-23-11-15-8-16(12-23)10-17(9-15)13-23/h14-18,28H,4-13H2,1-3H3,(H,25,29) |
| InChIKey | IBPXERAUIBRXTD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |