C20H30N4O — CID 25014045
N-(2-adamantyl)-1-methyl-5-piperidin-1-ylpyrazole-4-carboxamide (PubChem CID 25014045) has the molecular formula C20H30N4O and a molecular weight of 342.49 g/mol. Its IUPAC name is N-(2-adamantyl)-1-methyl-5-piperidin-1-ylpyrazole-4-carboxamide.
| Compound Name | N-(2-adamantyl)-1-methyl-5-piperidin-1-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 25014045 |
| Molecular Formula | C20H30N4O |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | N-(2-adamantyl)-1-methyl-5-piperidin-1-ylpyrazole-4-carboxamide |
| SMILES | Cn1ncc(C(=O)NC2C3CC4CC(C3)CC2C4)c1N1CCCCC1 |
| InChI | InChI=1S/C20H30N4O/c1-23-20(24-5-3-2-4-6-24)17(12-21-23)19(25)22-18-15-8-13-7-14(10-15)11-16(18)9-13/h12-16,18H,2-11H2,1H3,(H,22,25) |
| InChIKey | QRPFPZTWMVXVIA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |