C16H23N3O — CID 19279634
N-(2-adamantyl)-1,5-dimethylpyrazole-3-carboxamide (PubChem CID 19279634) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is N-(2-adamantyl)-1,5-dimethylpyrazole-3-carboxamide.
| Compound Name | N-(2-adamantyl)-1,5-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19279634 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | N-(2-adamantyl)-1,5-dimethylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC2C3CC4CC(C3)CC2C4)nn1C |
| InChI | InChI=1S/C16H23N3O/c1-9-3-14(18-19(9)2)16(20)17-15-12-5-10-4-11(7-12)8-13(15)6-10/h3,10-13,15H,4-8H2,1-2H3,(H,17,20) |
| InChIKey | HDVOVBYGDKTSLY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |