C25H38N4O5 — CID 90961248
N-(5-hydroxy-2-adamantyl)-1-[4-(methoxyamino)-3,3-dimethyl-4-oxobut-1-enyl]-5-(2-methylpropoxy)pyrazole-4-carboxamide (PubChem CID 90961248) has the molecular formula C25H38N4O5 and a molecular weight of 474.60 g/mol. Its IUPAC name is N-(5-hydroxy-2-adamantyl)-1-[4-(methoxyamino)-3,3-dimethyl-4-oxobut-1-enyl]-5-(2-methylpropoxy)pyrazole-4-carboxamide.
| Compound Name | N-(5-hydroxy-2-adamantyl)-1-[4-(methoxyamino)-3,3-dimethyl-4-oxobut-1-enyl]-5-(2-methylpropoxy)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 90961248 |
| Molecular Formula | C25H38N4O5 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | N-(5-hydroxy-2-adamantyl)-1-[4-(methoxyamino)-3,3-dimethyl-4-oxobut-1-enyl]-5-(2-methylpropoxy)pyrazole-4-carboxamide |
| SMILES | CONC(=O)C(C)(C)C=Cn1ncc(C(=O)NC2C3CC4CC2CC(O)(C4)C3)c1OCC(C)C |
| InChI | InChI=1S/C25H38N4O5/c1-15(2)14-34-22-19(13-26-29(22)7-6-24(3,4)23(31)28-33-5)21(30)27-20-17-8-16-9-18(20)12-25(32,10-16)11-17/h6-7,13,15-18,20,32H,8-12,14H2,1-5H3,(H,27,30)(H,28,31) |
| InChIKey | KHDOCMDWEAYYTC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|