C27H41N5O5 — CID 91221779
1-(3-acetamido-3-methylbut-1-enyl)-N-[5-(methoxycarbamoyl)-2-adamantyl]-5-(2-methylpropoxy)pyrazole-4-carboxamide (PubChem CID 91221779) has the molecular formula C27H41N5O5 and a molecular weight of 515.66 g/mol. Its IUPAC name is 1-(3-acetamido-3-methylbut-1-enyl)-N-[5-(methoxycarbamoyl)-2-adamantyl]-5-(2-methylpropoxy)pyrazole-4-carboxamide.
| Compound Name | 1-(3-acetamido-3-methylbut-1-enyl)-N-[5-(methoxycarbamoyl)-2-adamantyl]-5-(2-methylpropoxy)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 91221779 |
| Molecular Formula | C27H41N5O5 |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.31 |
| IUPAC Name | 1-(3-acetamido-3-methylbut-1-enyl)-N-[5-(methoxycarbamoyl)-2-adamantyl]-5-(2-methylpropoxy)pyrazole-4-carboxamide |
| SMILES | CONC(=O)C12CC3CC(C1)C(NC(=O)c1cnn(C=CC(C)(C)NC(C)=O)c1OCC(C)C)C(C3)C2 |
| InChI | InChI=1S/C27H41N5O5/c1-16(2)15-37-24-21(14-28-32(24)8-7-26(4,5)30-17(3)33)23(34)29-22-19-9-18-10-20(22)13-27(11-18,12-19)25(35)31-36-6/h7-8,14,16,18-20,22H,9-13,15H2,1-6H3,(H,29,34)(H,30,33)(H,31,35) |
| InChIKey | RQZKNEHXFFSUBV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|