C19H25N3O3S2 — CID 139008424
N-(1-benzylpiperidin-3-yl)-N-methyl-4-(methylsulfamoyl)thiophene-2-carboxamide (PubChem CID 139008424) has the molecular formula C19H25N3O3S2 and a molecular weight of 407.56 g/mol. Its IUPAC name is N-(1-benzylpiperidin-3-yl)-N-methyl-4-(methylsulfamoyl)thiophene-2-carboxamide.
| Compound Name | N-(1-benzylpiperidin-3-yl)-N-methyl-4-(methylsulfamoyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 139008424 |
| Molecular Formula | C19H25N3O3S2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-(1-benzylpiperidin-3-yl)-N-methyl-4-(methylsulfamoyl)thiophene-2-carboxamide |
| SMILES | CNS(=O)(=O)c1csc(C(=O)N(C)C2CCCN(Cc3ccccc3)C2)c1 |
| InChI | InChI=1S/C19H25N3O3S2/c1-20-27(24,25)17-11-18(26-14-17)19(23)21(2)16-9-6-10-22(13-16)12-15-7-4-3-5-8-15/h3-5,7-8,11,14,16,20H,6,9-10,12-13H2,1-2H3 |
| InChIKey | DHBUVEWIAKEIFO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |