C18H22N2O3S2 — CID 56876296
N-methyl-4-[[3-(thiophene-2-carbonyl)piperidin-1-yl]methyl]benzenesulfonamide (PubChem CID 56876296) has the molecular formula C18H22N2O3S2 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-methyl-4-[[3-(thiophene-2-carbonyl)piperidin-1-yl]methyl]benzenesulfonamide.
| Compound Name | N-methyl-4-[[3-(thiophene-2-carbonyl)piperidin-1-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 56876296 |
| Molecular Formula | C18H22N2O3S2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | N-methyl-4-[[3-(thiophene-2-carbonyl)piperidin-1-yl]methyl]benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(CN2CCCC(C(=O)c3cccs3)C2)cc1 |
| InChI | InChI=1S/C18H22N2O3S2/c1-19-25(22,23)16-8-6-14(7-9-16)12-20-10-2-4-15(13-20)18(21)17-5-3-11-24-17/h3,5-9,11,15,19H,2,4,10,12-13H2,1H3 |
| InChIKey | QMPYOAQLCOITNJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |