C17H23N3OS — CID 95215186
[(3S)-1-[(1-propan-2-ylimidazol-2-yl)methyl]piperidin-3-yl]-thiophen-2-ylmethanone (PubChem CID 95215186) has the molecular formula C17H23N3OS and a molecular weight of 317.46 g/mol. Its IUPAC name is [(3S)-1-[(1-propan-2-ylimidazol-2-yl)methyl]piperidin-3-yl]-thiophen-2-ylmethanone.
| Compound Name | [(3S)-1-[(1-propan-2-ylimidazol-2-yl)methyl]piperidin-3-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 95215186 |
| Molecular Formula | C17H23N3OS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | [(3S)-1-[(1-propan-2-ylimidazol-2-yl)methyl]piperidin-3-yl]-thiophen-2-ylmethanone |
| SMILES | CC(C)n1ccnc1CN1CCC[C@H](C(=O)c2cccs2)C1 |
| InChI | InChI=1S/C17H23N3OS/c1-13(2)20-9-7-18-16(20)12-19-8-3-5-14(11-19)17(21)15-6-4-10-22-15/h4,6-7,9-10,13-14H,3,5,8,11-12H2,1-2H3/t14-/m0/s1 |
| InChIKey | SAHSWAOEVNOPER-AWEZNQCLSA-N |
| XLogP | 3.62 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |