C14H19N5OS — CID 135099465
[1-[3-(tetrazol-1-yl)propyl]piperidin-3-yl]-thiophen-2-ylmethanone (PubChem CID 135099465) has the molecular formula C14H19N5OS and a molecular weight of 305.41 g/mol. Its IUPAC name is [1-[3-(tetrazol-1-yl)propyl]piperidin-3-yl]-thiophen-2-ylmethanone.
| Compound Name | [1-[3-(tetrazol-1-yl)propyl]piperidin-3-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 135099465 |
| Molecular Formula | C14H19N5OS |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | [1-[3-(tetrazol-1-yl)propyl]piperidin-3-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)C1CCCN(CCCn2cnnn2)C1 |
| InChI | InChI=1S/C14H19N5OS/c20-14(13-5-2-9-21-13)12-4-1-6-18(10-12)7-3-8-19-11-15-16-17-19/h2,5,9,11-12H,1,3-4,6-8,10H2 |
| InChIKey | BHBHZWLGEKQSLN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |