C19H20N4OS — CID 139011250
N-(1-benzylpyrrolidin-3-yl)-5-thiophen-3-yl-1H-pyrazole-4-carboxamide (PubChem CID 139011250) has the molecular formula C19H20N4OS and a molecular weight of 352.46 g/mol. Its IUPAC name is N-(1-benzylpyrrolidin-3-yl)-5-thiophen-3-yl-1H-pyrazole-4-carboxamide.
| Compound Name | N-(1-benzylpyrrolidin-3-yl)-5-thiophen-3-yl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 139011250 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | N-(1-benzylpyrrolidin-3-yl)-5-thiophen-3-yl-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)C1)c1cn[nH]c1-c1ccsc1 |
| InChI | InChI=1S/C19H20N4OS/c24-19(17-10-20-22-18(17)15-7-9-25-13-15)21-16-6-8-23(12-16)11-14-4-2-1-3-5-14/h1-5,7,9-10,13,16H,6,8,11-12H2,(H,20,22)(H,21,24) |
| InChIKey | XVDFRBAPMUUWJZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |