C23H25F3N4O — CID 139013237
4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-N-[[5-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]methyl]aniline (PubChem CID 139013237) has the molecular formula C23H25F3N4O and a molecular weight of 430.47 g/mol. Its IUPAC name is 4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-N-[[5-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]methyl]aniline.
| Compound Name | 4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-N-[[5-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]methyl]aniline |
|---|---|
| PubChem CID | 139013237 |
| Molecular Formula | C23H25F3N4O |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-N-[[5-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]methyl]aniline |
| SMILES | C[C@@H]1CN(c2ccc(NCc3cn[nH]c3-c3ccc(C(F)(F)F)cc3)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C23H25F3N4O/c1-15-13-30(14-16(2)31-15)21-9-7-20(8-10-21)27-11-18-12-28-29-22(18)17-3-5-19(6-4-17)23(24,25)26/h3-10,12,15-16,27H,11,13-14H2,1-2H3,(H,28,29)/t15-,16+ |
| InChIKey | DSOZWKVOLGJFGV-IYBDPMFKSA-N |
| XLogP | 5.32 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|