C19H19ClN6O3 — CID 139016213
1-[2-(2-chlorophenoxy)ethyl]-5-[3-(2H-tetrazol-5-yl)pyrrolidine-1-carbonyl]pyridin-2-one (PubChem CID 139016213) has the molecular formula C19H19ClN6O3 and a molecular weight of 414.85 g/mol. Its IUPAC name is 1-[2-(2-chlorophenoxy)ethyl]-5-[3-(2H-tetrazol-5-yl)pyrrolidine-1-carbonyl]pyridin-2-one.
| Compound Name | 1-[2-(2-chlorophenoxy)ethyl]-5-[3-(2H-tetrazol-5-yl)pyrrolidine-1-carbonyl]pyridin-2-one |
|---|---|
| PubChem CID | 139016213 |
| Molecular Formula | C19H19ClN6O3 |
| Molecular Weight | 414.85 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 1-[2-(2-chlorophenoxy)ethyl]-5-[3-(2H-tetrazol-5-yl)pyrrolidine-1-carbonyl]pyridin-2-one |
| SMILES | O=C(c1ccc(=O)n(CCOc2ccccc2Cl)c1)N1CCC(c2nn[nH]n2)C1 |
| InChI | InChI=1S/C19H19ClN6O3/c20-15-3-1-2-4-16(15)29-10-9-25-12-14(5-6-17(25)27)19(28)26-8-7-13(11-26)18-21-23-24-22-18/h1-6,12-13H,7-11H2,(H,21,22,23,24) |
| InChIKey | BEJDSWULRHAINR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 106.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.85 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |