C17H24N3O4P — CID 139016394
2-diethoxyphosphoryl-N-[2-[(3-methylphenyl)methyl]pyrazol-3-yl]acetamide (PubChem CID 139016394) has the molecular formula C17H24N3O4P and a molecular weight of 365.37 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-N-[2-[(3-methylphenyl)methyl]pyrazol-3-yl]acetamide.
| Compound Name | 2-diethoxyphosphoryl-N-[2-[(3-methylphenyl)methyl]pyrazol-3-yl]acetamide |
|---|---|
| PubChem CID | 139016394 |
| Molecular Formula | C17H24N3O4P |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 2-diethoxyphosphoryl-N-[2-[(3-methylphenyl)methyl]pyrazol-3-yl]acetamide |
| SMILES | CCOP(=O)(CC(=O)Nc1ccnn1Cc1cccc(C)c1)OCC |
| InChI | InChI=1S/C17H24N3O4P/c1-4-23-25(22,24-5-2)13-17(21)19-16-9-10-18-20(16)12-15-8-6-7-14(3)11-15/h6-11H,4-5,12-13H2,1-3H3,(H,19,21) |
| InChIKey | ACDNKZGJNOQXLN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|