C18H21N5OS — CID 55868588
2-(1-ethylimidazol-2-yl)sulfanyl-N-[2-[(3-methylphenyl)methyl]pyrazol-3-yl]acetamide (PubChem CID 55868588) has the molecular formula C18H21N5OS and a molecular weight of 355.47 g/mol. Its IUPAC name is 2-(1-ethylimidazol-2-yl)sulfanyl-N-[2-[(3-methylphenyl)methyl]pyrazol-3-yl]acetamide.
| Compound Name | 2-(1-ethylimidazol-2-yl)sulfanyl-N-[2-[(3-methylphenyl)methyl]pyrazol-3-yl]acetamide |
|---|---|
| PubChem CID | 55868588 |
| Molecular Formula | C18H21N5OS |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 2-(1-ethylimidazol-2-yl)sulfanyl-N-[2-[(3-methylphenyl)methyl]pyrazol-3-yl]acetamide |
| SMILES | CCn1ccnc1SCC(=O)Nc1ccnn1Cc1cccc(C)c1 |
| InChI | InChI=1S/C18H21N5OS/c1-3-22-10-9-19-18(22)25-13-17(24)21-16-7-8-20-23(16)12-15-6-4-5-14(2)11-15/h4-11H,3,12-13H2,1-2H3,(H,21,24) |
| InChIKey | DKQGUANOAYNUAE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |