C12H18N4 — CID 139016896
4,5-dimethyl-N-[(4-methyl-3-pyridinyl)methyl]imidazolidin-2-imine (PubChem CID 139016896) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is 4,5-dimethyl-N-[(4-methyl-3-pyridinyl)methyl]imidazolidin-2-imine.
| Compound Name | 4,5-dimethyl-N-[(4-methyl-3-pyridinyl)methyl]imidazolidin-2-imine |
|---|---|
| PubChem CID | 139016896 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 4,5-dimethyl-N-[(4-methyl-3-pyridinyl)methyl]imidazolidin-2-imine |
| SMILES | Cc1ccncc1CN=C1NC(C)C(C)N1 |
| InChI | InChI=1S/C12H18N4/c1-8-4-5-13-6-11(8)7-14-12-15-9(2)10(3)16-12/h4-6,9-10H,7H2,1-3H3,(H2,14,15,16) |
| InChIKey | DMAAEVYGDSZNFQ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|