C8H11N3O — CID 83873294
N'-hydroxy-2-(4-methyl-3-pyridinyl)ethanimidamide (PubChem CID 83873294) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is N'-hydroxy-2-(4-methyl-3-pyridinyl)ethanimidamide.
| Compound Name | N'-hydroxy-2-(4-methyl-3-pyridinyl)ethanimidamide |
|---|---|
| PubChem CID | 83873294 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | N'-hydroxy-2-(4-methyl-3-pyridinyl)ethanimidamide |
| SMILES | Cc1ccncc1C/C(N)=N/O |
| InChI | InChI=1S/C8H11N3O/c1-6-2-3-10-5-7(6)4-8(9)11-12/h2-3,5,12H,4H2,1H3,(H2,9,11) |
| InChIKey | KFHIBDZLRGLFKH-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|