C14H24N4O — CID 114956355
N'-hydroxy-2,2-dimethyl-5-[(4-methyl-3-pyridinyl)methylamino]pentanimidamide (PubChem CID 114956355) has the molecular formula C14H24N4O and a molecular weight of 264.37 g/mol. Its IUPAC name is N'-hydroxy-2,2-dimethyl-5-[(4-methyl-3-pyridinyl)methylamino]pentanimidamide.
| Compound Name | N'-hydroxy-2,2-dimethyl-5-[(4-methyl-3-pyridinyl)methylamino]pentanimidamide |
|---|---|
| PubChem CID | 114956355 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | N'-hydroxy-2,2-dimethyl-5-[(4-methyl-3-pyridinyl)methylamino]pentanimidamide |
| SMILES | Cc1ccncc1CNCCCC(C)(C)/C(N)=N/O |
| InChI | InChI=1S/C14H24N4O/c1-11-5-8-17-10-12(11)9-16-7-4-6-14(2,3)13(15)18-19/h5,8,10,16,19H,4,6-7,9H2,1-3H3,(H2,15,18) |
| InChIKey | VNDFBYFUTTTWJM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|