C13H19N3O3S — CID 139017835
(3R)-3-ethyl-4-[(5-methyl-3-pyridinyl)sulfonyl]-1,4-diazepan-2-one (PubChem CID 139017835) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is (3R)-3-ethyl-4-[(5-methyl-3-pyridinyl)sulfonyl]-1,4-diazepan-2-one.
| Compound Name | (3R)-3-ethyl-4-[(5-methyl-3-pyridinyl)sulfonyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 139017835 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | (3R)-3-ethyl-4-[(5-methyl-3-pyridinyl)sulfonyl]-1,4-diazepan-2-one |
| SMILES | CC[C@@H]1C(=O)NCCCN1S(=O)(=O)c1cncc(C)c1 |
| InChI | InChI=1S/C13H19N3O3S/c1-3-12-13(17)15-5-4-6-16(12)20(18,19)11-7-10(2)8-14-9-11/h7-9,12H,3-6H2,1-2H3,(H,15,17)/t12-/m1/s1 |
| InChIKey | WKOGKTKEGHKSNS-GFCCVEGCSA-N |
| XLogP | 0.68 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |