C10H12IN3O2 — CID 139018133
N-(1-cyanobutan-2-yl)-4-iodo-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 139018133) has the molecular formula C10H12IN3O2 and a molecular weight of 333.13 g/mol. Its IUPAC name is N-(1-cyanobutan-2-yl)-4-iodo-5-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-(1-cyanobutan-2-yl)-4-iodo-5-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 139018133 |
| Molecular Formula | C10H12IN3O2 |
| Molecular Weight | 333.13 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | N-(1-cyanobutan-2-yl)-4-iodo-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | CCC(CC#N)NC(=O)c1noc(C)c1I |
| InChI | InChI=1S/C10H12IN3O2/c1-3-7(4-5-12)13-10(15)9-8(11)6(2)16-14-9/h7H,3-4H2,1-2H3,(H,13,15) |
| InChIKey | HEYNLFVWQFGWDZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.13 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|