C9H15NO3S — CID 139020035
N-(2-methyl-1,1-dioxothian-4-yl)prop-2-enamide (PubChem CID 139020035) has the molecular formula C9H15NO3S and a molecular weight of 217.29 g/mol. Its IUPAC name is N-(2-methyl-1,1-dioxothian-4-yl)prop-2-enamide.
| Compound Name | N-(2-methyl-1,1-dioxothian-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 139020035 |
| Molecular Formula | C9H15NO3S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | N-(2-methyl-1,1-dioxothian-4-yl)prop-2-enamide |
| SMILES | C=CC(=O)NC1CCS(=O)(=O)C(C)C1 |
| InChI | InChI=1S/C9H15NO3S/c1-3-9(11)10-8-4-5-14(12,13)7(2)6-8/h3,7-8H,1,4-6H2,2H3,(H,10,11) |
| InChIKey | QDDZDDRSDOXZFX-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|