C11H19NO — CID 164736276
N-[(3R)-3-propan-2-ylcyclopentyl]prop-2-enamide (PubChem CID 164736276) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is N-[(3R)-3-propan-2-ylcyclopentyl]prop-2-enamide.
| Compound Name | N-[(3R)-3-propan-2-ylcyclopentyl]prop-2-enamide |
|---|---|
| PubChem CID | 164736276 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | N-[(3R)-3-propan-2-ylcyclopentyl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CC[C@@H](C(C)C)C1 |
| InChI | InChI=1S/C11H19NO/c1-4-11(13)12-10-6-5-9(7-10)8(2)3/h4,8-10H,1,5-7H2,2-3H3,(H,12,13)/t9-,10?/m1/s1 |
| InChIKey | NTTFTLWAXCAVOI-YHMJZVADSA-N |
| XLogP | 2.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|