C20H24FN3O3 — CID 139020440
N'-(8-fluoroquinolin-3-yl)-N-[2-(1-hydroxycyclopentyl)-2-methylpropyl]oxamide (PubChem CID 139020440) has the molecular formula C20H24FN3O3 and a molecular weight of 373.43 g/mol. Its IUPAC name is N'-(8-fluoroquinolin-3-yl)-N-[2-(1-hydroxycyclopentyl)-2-methylpropyl]oxamide.
| Compound Name | N'-(8-fluoroquinolin-3-yl)-N-[2-(1-hydroxycyclopentyl)-2-methylpropyl]oxamide |
|---|---|
| PubChem CID | 139020440 |
| Molecular Formula | C20H24FN3O3 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N'-(8-fluoroquinolin-3-yl)-N-[2-(1-hydroxycyclopentyl)-2-methylpropyl]oxamide |
| SMILES | CC(C)(CNC(=O)C(=O)Nc1cnc2c(F)cccc2c1)C1(O)CCCC1 |
| InChI | InChI=1S/C20H24FN3O3/c1-19(2,20(27)8-3-4-9-20)12-23-17(25)18(26)24-14-10-13-6-5-7-15(21)16(13)22-11-14/h5-7,10-11,27H,3-4,8-9,12H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | DGGNRFGMFOFOSN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|