C16H26N4OS — CID 139020902
(3aR,6aR)-5-(3-ethyl-1,2,4-thiadiazol-5-yl)-3a-(piperidin-1-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole (PubChem CID 139020902) has the molecular formula C16H26N4OS and a molecular weight of 322.48 g/mol. Its IUPAC name is (3aR,6aR)-5-(3-ethyl-1,2,4-thiadiazol-5-yl)-3a-(piperidin-1-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole.
| Compound Name | (3aR,6aR)-5-(3-ethyl-1,2,4-thiadiazol-5-yl)-3a-(piperidin-1-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 139020902 |
| Molecular Formula | C16H26N4OS |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | (3aR,6aR)-5-(3-ethyl-1,2,4-thiadiazol-5-yl)-3a-(piperidin-1-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole |
| SMILES | CCc1nsc(N2C[C@@H]3COC[C@]3(CN3CCCCC3)C2)n1 |
| InChI | InChI=1S/C16H26N4OS/c1-2-14-17-15(22-18-14)20-8-13-9-21-12-16(13,11-20)10-19-6-4-3-5-7-19/h13H,2-12H2,1H3/t13-,16+/m1/s1 |
| InChIKey | SREHOAJDTDQFEJ-CJNGLKHVSA-N |
| XLogP | 2.04 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |