C13H21N3O2S — CID 162628157
(3aR,6aS)-3a-(methoxymethyl)-5-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole (PubChem CID 162628157) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is (3aR,6aS)-3a-(methoxymethyl)-5-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole.
| Compound Name | (3aR,6aS)-3a-(methoxymethyl)-5-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 162628157 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | (3aR,6aS)-3a-(methoxymethyl)-5-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole |
| SMILES | COC[C@@]12COC[C@@H]1CN(c1nnc(C(C)C)s1)C2 |
| InChI | InChI=1S/C13H21N3O2S/c1-9(2)11-14-15-12(19-11)16-4-10-5-18-8-13(10,6-16)7-17-3/h9-10H,4-8H2,1-3H3/t10-,13-/m0/s1 |
| InChIKey | KKIDLMFMJILOQJ-GWCFXTLKSA-N |
| XLogP | 1.76 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |