C19H25BN2O4 — CID 139021300
3-[2-oxo-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidin-1-yl]ethoxy]benzonitrile (PubChem CID 139021300) has the molecular formula C19H25BN2O4 and a molecular weight of 356.23 g/mol. Its IUPAC name is 3-[2-oxo-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidin-1-yl]ethoxy]benzonitrile.
| Compound Name | 3-[2-oxo-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidin-1-yl]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 139021300 |
| Molecular Formula | C19H25BN2O4 |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 3-[2-oxo-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidin-1-yl]ethoxy]benzonitrile |
| SMILES | CC1(C)OB(C2CCN(C(=O)COc3cccc(C#N)c3)C2)OC1(C)C |
| InChI | InChI=1S/C19H25BN2O4/c1-18(2)19(3,4)26-20(25-18)15-8-9-22(12-15)17(23)13-24-16-7-5-6-14(10-16)11-21/h5-7,10,15H,8-9,12-13H2,1-4H3 |
| InChIKey | XYXAQSMPGLEGDK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|