C14H14F2N2O2S — CID 139021696
2-(cyanomethylsulfanyl)-N-[(2S,3R)-2-(3,4-difluorophenyl)oxolan-3-yl]acetamide (PubChem CID 139021696) has the molecular formula C14H14F2N2O2S and a molecular weight of 312.34 g/mol. Its IUPAC name is 2-(cyanomethylsulfanyl)-N-[(2S,3R)-2-(3,4-difluorophenyl)oxolan-3-yl]acetamide.
| Compound Name | 2-(cyanomethylsulfanyl)-N-[(2S,3R)-2-(3,4-difluorophenyl)oxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 139021696 |
| Molecular Formula | C14H14F2N2O2S |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 2-(cyanomethylsulfanyl)-N-[(2S,3R)-2-(3,4-difluorophenyl)oxolan-3-yl]acetamide |
| SMILES | N#CCSCC(=O)N[C@@H]1CCO[C@H]1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H14F2N2O2S/c15-10-2-1-9(7-11(10)16)14-12(3-5-20-14)18-13(19)8-21-6-4-17/h1-2,7,12,14H,3,5-6,8H2,(H,18,19)/t12-,14+/m1/s1 |
| InChIKey | SLOTXBOCIOZADU-OCCSQVGLSA-N |
| XLogP | 2.17 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|