C9H14O — CID 139024054
2-(1,1,2,2,3,3,4,4,5,5,5-undecadeuteriopentyl)furan (PubChem CID 139024054) has the molecular formula C9H14O and a molecular weight of 149.28 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,5,5,5-undecadeuteriopentyl)furan.
| Compound Name | 2-(1,1,2,2,3,3,4,4,5,5,5-undecadeuteriopentyl)furan |
|---|---|
| PubChem CID | 139024054 |
| Molecular Formula | C9H14O |
| Molecular Weight | 149.28 g/mol |
| Exact Mass | 149.17 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,5,5,5-undecadeuteriopentyl)furan |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])c1ccco1 |
| InChI | InChI=1S/C9H14O/c1-2-3-4-6-9-7-5-8-10-9/h5,7-8H,2-4,6H2,1H3/i1D3,2D2,3D2,4D2,6D2 |
| InChIKey | YVBAUDVGOFCUSG-WRAAEXSDSA-N |
| XLogP | 3.01 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |