C17H21NO2S — CID 139027234
3-cyclopropylidene-8-(3-methylphenyl)sulfonyl-8-azabicyclo[3.2.1]octane (PubChem CID 139027234) has the molecular formula C17H21NO2S and a molecular weight of 303.43 g/mol. Its IUPAC name is 3-cyclopropylidene-8-(3-methylphenyl)sulfonyl-8-azabicyclo[3.2.1]octane.
| Compound Name | 3-cyclopropylidene-8-(3-methylphenyl)sulfonyl-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 139027234 |
| Molecular Formula | C17H21NO2S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 3-cyclopropylidene-8-(3-methylphenyl)sulfonyl-8-azabicyclo[3.2.1]octane |
| SMILES | Cc1cccc(S(=O)(=O)N2C3CCC2CC(=C2CC2)C3)c1 |
| InChI | InChI=1S/C17H21NO2S/c1-12-3-2-4-17(9-12)21(19,20)18-15-7-8-16(18)11-14(10-15)13-5-6-13/h2-4,9,15-16H,5-8,10-11H2,1H3 |
| InChIKey | MSGIOMXMUKCSCD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|