C22H30N4O4 — CID 139028024
N'-[4-methyl-3-(2-oxopyrrolidin-1-yl)phenyl]-N-[(1-morpholin-4-ylcyclobutyl)methyl]oxamide (PubChem CID 139028024) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is N'-[4-methyl-3-(2-oxopyrrolidin-1-yl)phenyl]-N-[(1-morpholin-4-ylcyclobutyl)methyl]oxamide.
| Compound Name | N'-[4-methyl-3-(2-oxopyrrolidin-1-yl)phenyl]-N-[(1-morpholin-4-ylcyclobutyl)methyl]oxamide |
|---|---|
| PubChem CID | 139028024 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | N'-[4-methyl-3-(2-oxopyrrolidin-1-yl)phenyl]-N-[(1-morpholin-4-ylcyclobutyl)methyl]oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)NCC2(N3CCOCC3)CCC2)cc1N1CCCC1=O |
| InChI | InChI=1S/C22H30N4O4/c1-16-5-6-17(14-18(16)26-9-2-4-19(26)27)24-21(29)20(28)23-15-22(7-3-8-22)25-10-12-30-13-11-25/h5-6,14H,2-4,7-13,15H2,1H3,(H,23,28)(H,24,29) |
| InChIKey | IOYBXYKSRQJZGL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|