C16H19F3N4O3 — CID 139028801
N-(oxan-4-yl)-3-oxo-4-[2-(trifluoromethyl)-4-pyridinyl]piperazine-1-carboxamide (PubChem CID 139028801) has the molecular formula C16H19F3N4O3 and a molecular weight of 372.35 g/mol. Its IUPAC name is N-(oxan-4-yl)-3-oxo-4-[2-(trifluoromethyl)-4-pyridinyl]piperazine-1-carboxamide.
| Compound Name | N-(oxan-4-yl)-3-oxo-4-[2-(trifluoromethyl)-4-pyridinyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 139028801 |
| Molecular Formula | C16H19F3N4O3 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | N-(oxan-4-yl)-3-oxo-4-[2-(trifluoromethyl)-4-pyridinyl]piperazine-1-carboxamide |
| SMILES | O=C(NC1CCOCC1)N1CCN(c2ccnc(C(F)(F)F)c2)C(=O)C1 |
| InChI | InChI=1S/C16H19F3N4O3/c17-16(18,19)13-9-12(1-4-20-13)23-6-5-22(10-14(23)24)15(25)21-11-2-7-26-8-3-11/h1,4,9,11H,2-3,5-8,10H2,(H,21,25) |
| InChIKey | COFSBKNCJRCLPA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |