C19H18N4O — CID 139030485
5-[1-[(4-methoxyphenyl)methyl]indol-6-yl]-1H-pyrazol-3-amine (PubChem CID 139030485) has the molecular formula C19H18N4O and a molecular weight of 318.38 g/mol. Its IUPAC name is 5-[1-[(4-methoxyphenyl)methyl]indol-6-yl]-1H-pyrazol-3-amine.
| Compound Name | 5-[1-[(4-methoxyphenyl)methyl]indol-6-yl]-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 139030485 |
| Molecular Formula | C19H18N4O |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 5-[1-[(4-methoxyphenyl)methyl]indol-6-yl]-1H-pyrazol-3-amine |
| SMILES | COc1ccc(Cn2ccc3ccc(-c4cc(N)n[nH]4)cc32)cc1 |
| InChI | InChI=1S/C19H18N4O/c1-24-16-6-2-13(3-7-16)12-23-9-8-14-4-5-15(10-18(14)23)17-11-19(20)22-21-17/h2-11H,12H2,1H3,(H3,20,21,22) |
| InChIKey | OQIZQMWQHPDPIM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 68.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |