C17H23NO2 — CID 139032435
(3R,11S)-11-methyl-3-phenyl-1-oxa-4-azacyclododec-8-en-12-one (PubChem CID 139032435) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is (3R,11S)-11-methyl-3-phenyl-1-oxa-4-azacyclododec-8-en-12-one.
| Compound Name | (3R,11S)-11-methyl-3-phenyl-1-oxa-4-azacyclododec-8-en-12-one |
|---|---|
| PubChem CID | 139032435 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | (3R,11S)-11-methyl-3-phenyl-1-oxa-4-azacyclododec-8-en-12-one |
| SMILES | C[C@H]1CC=CCCCN[C@H](c2ccccc2)COC1=O |
| InChI | InChI=1S/C17H23NO2/c1-14-9-5-2-3-8-12-18-16(13-20-17(14)19)15-10-6-4-7-11-15/h2,4-7,10-11,14,16,18H,3,8-9,12-13H2,1H3/t14-,16-/m0/s1 |
| InChIKey | YAIMJASQNYPANM-HOCLYGCPSA-N |
| XLogP | 3.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|