About diethylamino(oxo)azanium
diethylamino(oxo)azanium (PubChem CID 139032465) has the molecular formula C4H11N2O+
and a molecular weight of 103.14 g/mol. Its IUPAC name is diethylamino(oxo)azanium.
Molecular Properties
| Compound Name | diethylamino(oxo)azanium |
| PubChem CID | 139032465 |
| Molecular Formula | C4H11N2O+ |
| Molecular Weight | 103.14 g/mol |
| Exact Mass | 103.09 |
| IUPAC Name | diethylamino(oxo)azanium |
| SMILES | CCN(CC)[NH+]=O |
| InChI | InChI=1S/C4H10N2O/c1-3-6(4-2)5-7/h3-4H2,1-2H3/p+1 |
| InChIKey | WBNQDOYYEUMPFS-UHFFFAOYSA-O |
| XLogP | -0.91 |
| TPSA | 34.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.14 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze diethylamino(oxo)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethylamino(oxo)azanium?
The IUPAC name of diethylamino(oxo)azanium (CID 139032465) is diethylamino(oxo)azanium.
What is the SMILES notation for diethylamino(oxo)azanium?
The canonical SMILES for diethylamino(oxo)azanium is CCN(CC)[NH+]=O.
What is the InChIKey of diethylamino(oxo)azanium?
The InChIKey is WBNQDOYYEUMPFS-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H10N2O/c1-3-6(4-2)5-7/h3-4H2,1-2H3/p+1.
What are the key properties of diethylamino(oxo)azanium?
diethylamino(oxo)azanium has a molecular weight of 103.14 g/mol, XLogP of -0.91, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diethylamino(oxo)azanium is sourced from PubChem (CID 139032465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).